C26H27N3O2S — CID 10259280
N-[(1R,2R)-2-amino-1,2-diphenylethyl]-5-(dimethylamino)naphthalene-1-sulfonamide (PubChem CID 10259280) has the molecular formula C26H27N3O2S and a molecular weight of 445.59 g/mol. Its IUPAC name is N-[(1R,2R)-2-amino-1,2-diphenylethyl]-5-(dimethylamino)naphthalene-1-sulfonamide.
| Compound Name | N-[(1R,2R)-2-amino-1,2-diphenylethyl]-5-(dimethylamino)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 10259280 |
| Molecular Formula | C26H27N3O2S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[(1R,2R)-2-amino-1,2-diphenylethyl]-5-(dimethylamino)naphthalene-1-sulfonamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N[C@H](c3ccccc3)[C@H](N)c3ccccc3)cccc12 |
| InChI | InChI=1S/C26H27N3O2S/c1-29(2)23-17-9-16-22-21(23)15-10-18-24(22)32(30,31)28-26(20-13-7-4-8-14-20)25(27)19-11-5-3-6-12-19/h3-18,25-26,28H,27H2,1-2H3/t25-,26-/m1/s1 |
| InChIKey | CZVXMPYMWAKWEV-CLJLJLNGSA-N |
| XLogP | 4.63 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |