C20H19N2NaO5S2 — CID 58915463
sodium 2-[[(1S,2S)-2-amino-1,2-diphenylethyl]sulfamoyl]benzenesulfonate (PubChem CID 58915463) has the molecular formula C20H19N2NaO5S2 and a molecular weight of 454.51 g/mol. Its IUPAC name is sodium 2-[[(1S,2S)-2-amino-1,2-diphenylethyl]sulfamoyl]benzenesulfonate.
| Compound Name | sodium 2-[[(1S,2S)-2-amino-1,2-diphenylethyl]sulfamoyl]benzenesulfonate |
|---|---|
| PubChem CID | 58915463 |
| Molecular Formula | C20H19N2NaO5S2 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | sodium 2-[[(1S,2S)-2-amino-1,2-diphenylethyl]sulfamoyl]benzenesulfonate |
| SMILES | N[C@@H](c1ccccc1)[C@@H](NS(=O)(=O)c1ccccc1S(=O)(=O)[O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C20H20N2O5S2.Na/c21-19(15-9-3-1-4-10-15)20(16-11-5-2-6-12-16)22-28(23,24)17-13-7-8-14-18(17)29(25,26)27;/h1-14,19-20,22H,21H2,(H,25,26,27);/q;+1/p-1/t19-,20-;/m0./s1 |
| InChIKey | UIRMPYXBKMTYJJ-FKLPMGAJSA-M |
| XLogP | -0.69 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|