C21H20N2O7S2 — CID 58915465
5-[[(1R,2R)-2-amino-1,2-diphenylethyl]sulfamoyl]-2-sulfobenzoic acid (PubChem CID 58915465) has the molecular formula C21H20N2O7S2 and a molecular weight of 476.53 g/mol. Its IUPAC name is 5-[[(1R,2R)-2-amino-1,2-diphenylethyl]sulfamoyl]-2-sulfobenzoic acid.
| Compound Name | 5-[[(1R,2R)-2-amino-1,2-diphenylethyl]sulfamoyl]-2-sulfobenzoic acid |
|---|---|
| PubChem CID | 58915465 |
| Molecular Formula | C21H20N2O7S2 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 5-[[(1R,2R)-2-amino-1,2-diphenylethyl]sulfamoyl]-2-sulfobenzoic acid |
| SMILES | NC(c1ccccc1)[C@H](NS(=O)(=O)c1ccc(S(=O)(=O)O)c(C(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O7S2/c22-19(14-7-3-1-4-8-14)20(15-9-5-2-6-10-15)23-31(26,27)16-11-12-18(32(28,29)30)17(13-16)21(24)25/h1-13,19-20,23H,22H2,(H,24,25)(H,28,29,30)/t19?,20-/m1/s1 |
| InChIKey | CHGZNUKVXPIMEA-GFOWMXPYSA-N |
| XLogP | 2.35 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|