C21H23ClN2O2S — CID 75110683
N-(2-amino-1,2-diphenylethyl)-4-methylbenzenesulfonamide;hydrochloride (PubChem CID 75110683) has the molecular formula C21H23ClN2O2S and a molecular weight of 402.95 g/mol. Its IUPAC name is N-(2-amino-1,2-diphenylethyl)-4-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-amino-1,2-diphenylethyl)-4-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 75110683 |
| Molecular Formula | C21H23ClN2O2S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-(2-amino-1,2-diphenylethyl)-4-methylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)NC(c2ccccc2)C(N)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C21H22N2O2S.ClH/c1-16-12-14-19(15-13-16)26(24,25)23-21(18-10-6-3-7-11-18)20(22)17-8-4-2-5-9-17;/h2-15,20-21,23H,22H2,1H3;1H |
| InChIKey | KELRRMRREFHMPP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |