C17H21NO4S — CID 101203373
N-[(1S)-2,2-dimethoxy-1-phenylethyl]-4-methylbenzenesulfonamide (PubChem CID 101203373) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is N-[(1S)-2,2-dimethoxy-1-phenylethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S)-2,2-dimethoxy-1-phenylethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 101203373 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-[(1S)-2,2-dimethoxy-1-phenylethyl]-4-methylbenzenesulfonamide |
| SMILES | COC(OC)[C@@H](NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H21NO4S/c1-13-9-11-15(12-10-13)23(19,20)18-16(17(21-2)22-3)14-7-5-4-6-8-14/h4-12,16-18H,1-3H3/t16-/m0/s1 |
| InChIKey | XRWIHEUSTPSLAA-INIZCTEOSA-N |
| XLogP | 2.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|