C20H20N2O5S2 — CID 58915462
4-[[(1S,2S)-2-amino-1,2-diphenylethyl]sulfamoyl]benzenesulfonic acid (PubChem CID 58915462) has the molecular formula C20H20N2O5S2 and a molecular weight of 432.52 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-amino-1,2-diphenylethyl]sulfamoyl]benzenesulfonic acid.
| Compound Name | 4-[[(1S,2S)-2-amino-1,2-diphenylethyl]sulfamoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58915462 |
| Molecular Formula | C20H20N2O5S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 4-[[(1S,2S)-2-amino-1,2-diphenylethyl]sulfamoyl]benzenesulfonic acid |
| SMILES | N[C@@H](c1ccccc1)[C@@H](NS(=O)(=O)c1ccc(S(=O)(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O5S2/c21-19(15-7-3-1-4-8-15)20(16-9-5-2-6-10-16)22-28(23,24)17-11-13-18(14-12-17)29(25,26)27/h1-14,19-20,22H,21H2,(H,25,26,27)/t19-,20-/m0/s1 |
| InChIKey | OEAUQZTYDZXUNJ-PMACEKPBSA-N |
| XLogP | 2.65 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|