C20H19ClN2O2S — CID 23443554
N-(2-amino-1,2-diphenylethyl)-4-chlorobenzenesulfonamide (PubChem CID 23443554) has the molecular formula C20H19ClN2O2S and a molecular weight of 386.90 g/mol. Its IUPAC name is N-(2-amino-1,2-diphenylethyl)-4-chlorobenzenesulfonamide.
| Compound Name | N-(2-amino-1,2-diphenylethyl)-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 23443554 |
| Molecular Formula | C20H19ClN2O2S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-(2-amino-1,2-diphenylethyl)-4-chlorobenzenesulfonamide |
| SMILES | NC(c1ccccc1)C(NS(=O)(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H19ClN2O2S/c21-17-11-13-18(14-12-17)26(24,25)23-20(16-9-5-2-6-10-16)19(22)15-7-3-1-4-8-15/h1-14,19-20,23H,22H2 |
| InChIKey | XJPRQBJPIQYZTG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |