C25H30N2O2S — CID 23070407
N-(2-amino-1,2-diphenylethyl)-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 23070407) has the molecular formula C25H30N2O2S and a molecular weight of 422.59 g/mol. Its IUPAC name is N-(2-amino-1,2-diphenylethyl)-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-(2-amino-1,2-diphenylethyl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 23070407 |
| Molecular Formula | C25H30N2O2S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-(2-amino-1,2-diphenylethyl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NC(c2ccccc2)C(N)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C25H30N2O2S/c1-16-17(2)19(4)25(20(5)18(16)3)30(28,29)27-24(22-14-10-7-11-15-22)23(26)21-12-8-6-9-13-21/h6-15,23-24,27H,26H2,1-5H3 |
| InChIKey | MYDBAHCSGVEVFX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |