C32H38N2O2RuS — CID 87738343
N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,4,6-trimethylbenzenesulfonamide;ruthenium;1,2,4-trimethylbenzene (PubChem CID 87738343) has the molecular formula C32H38N2O2RuS and a molecular weight of 615.81 g/mol. Its IUPAC name is N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,4,6-trimethylbenzenesulfonamide;ruthenium;1,2,4-trimethylbenzene.
| Compound Name | N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,4,6-trimethylbenzenesulfonamide;ruthenium;1,2,4-trimethylbenzene |
|---|---|
| PubChem CID | 87738343 |
| Molecular Formula | C32H38N2O2RuS |
| Molecular Weight | 615.81 g/mol |
| Exact Mass | 616.17 |
| IUPAC Name | N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,4,6-trimethylbenzenesulfonamide;ruthenium;1,2,4-trimethylbenzene |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@@H](c2ccccc2)[C@@H](N)c2ccccc2)c(C)c1.Cc1ccc(C)c(C)c1.[Ru] |
| InChI | InChI=1S/C23H26N2O2S.C9H12.Ru/c1-16-14-17(2)23(18(3)15-16)28(26,27)25-22(20-12-8-5-9-13-20)21(24)19-10-6-4-7-11-19;1-7-4-5-8(2)9(3)6-7;/h4-15,21-22,25H,24H2,1-3H3;4-6H,1-3H3;/t21-,22-;;/m0../s1 |
| InChIKey | WCRNQYLELBQPMV-IXOXMDGESA-N |
| XLogP | 6.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.81 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |