C29H38N2O2S — CID 90254730
N-[(1S)-2-amino-1,2-diphenylethyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 90254730) has the molecular formula C29H38N2O2S and a molecular weight of 478.70 g/mol. Its IUPAC name is N-[(1S)-2-amino-1,2-diphenylethyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-[(1S)-2-amino-1,2-diphenylethyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 90254730 |
| Molecular Formula | C29H38N2O2S |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | N-[(1S)-2-amino-1,2-diphenylethyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N[C@@H](c2ccccc2)C(N)c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C29H38N2O2S/c1-19(2)24-17-25(20(3)4)29(26(18-24)21(5)6)34(32,33)31-28(23-15-11-8-12-16-23)27(30)22-13-9-7-10-14-22/h7-21,27-28,31H,30H2,1-6H3/t27?,28-/m0/s1 |
| InChIKey | FWSBAKFIRHTBCY-CPRJBALCSA-N |
| XLogP | 6.78 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |