C34H42N2O2RuS — CID 87738604
N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,3,4,5,6-pentamethylbenzenesulfonamide;ruthenium;1,3,5-trimethylbenzene (PubChem CID 87738604) has the molecular formula C34H42N2O2RuS and a molecular weight of 643.86 g/mol. Its IUPAC name is N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,3,4,5,6-pentamethylbenzenesulfonamide;ruthenium;1,3,5-trimethylbenzene.
| Compound Name | N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,3,4,5,6-pentamethylbenzenesulfonamide;ruthenium;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 87738604 |
| Molecular Formula | C34H42N2O2RuS |
| Molecular Weight | 643.86 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | N-[(1S,2S)-2-amino-1,2-diphenylethyl]-2,3,4,5,6-pentamethylbenzenesulfonamide;ruthenium;1,3,5-trimethylbenzene |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N[C@@H](c2ccccc2)[C@@H](N)c2ccccc2)c(C)c1C.Cc1cc(C)cc(C)c1.[Ru] |
| InChI | InChI=1S/C25H30N2O2S.C9H12.Ru/c1-16-17(2)19(4)25(20(5)18(16)3)30(28,29)27-24(22-14-10-7-11-15-22)23(26)21-12-8-6-9-13-21;1-7-4-8(2)6-9(3)5-7;/h6-15,23-24,27H,26H2,1-5H3;4-6H,1-3H3;/t23-,24-;;/m0../s1 |
| InChIKey | GJWQPFMACGUPCE-WLKYSPGFSA-N |
| XLogP | 7.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.86 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |