C20H21N3O2S — CID 89035973
4-amino-N-[(1S,2S)-2-amino-1,2-diphenylethyl]benzenesulfonamide (PubChem CID 89035973) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 4-amino-N-[(1S,2S)-2-amino-1,2-diphenylethyl]benzenesulfonamide.
| Compound Name | 4-amino-N-[(1S,2S)-2-amino-1,2-diphenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 89035973 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-amino-N-[(1S,2S)-2-amino-1,2-diphenylethyl]benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)N[C@@H](c2ccccc2)[C@@H](N)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c21-17-11-13-18(14-12-17)26(24,25)23-20(16-9-5-2-6-10-16)19(22)15-7-3-1-4-8-15/h1-14,19-20,23H,21-22H2/t19-,20-/m0/s1 |
| InChIKey | CSRTTYSBQMXEKN-PMACEKPBSA-N |
| XLogP | 2.99 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|