C22H24N2O4S — CID 122362570
N-(2-amino-1,2-diphenylethyl)-2,4-dimethoxybenzenesulfonamide (PubChem CID 122362570) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is N-(2-amino-1,2-diphenylethyl)-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(2-amino-1,2-diphenylethyl)-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 122362570 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N-(2-amino-1,2-diphenylethyl)-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(c2ccccc2)C(N)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C22H24N2O4S/c1-27-18-13-14-20(19(15-18)28-2)29(25,26)24-22(17-11-7-4-8-12-17)21(23)16-9-5-3-6-10-16/h3-15,21-22,24H,23H2,1-2H3 |
| InChIKey | DJVGCYOUWVNJIL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |