C22H24N2O3S — CID 59537325
N-(2-amino-1,2-diphenylethyl)-1-(3-methoxyphenyl)methanesulfonamide (PubChem CID 59537325) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-(2-amino-1,2-diphenylethyl)-1-(3-methoxyphenyl)methanesulfonamide.
| Compound Name | N-(2-amino-1,2-diphenylethyl)-1-(3-methoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 59537325 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-(2-amino-1,2-diphenylethyl)-1-(3-methoxyphenyl)methanesulfonamide |
| SMILES | COc1cccc(CS(=O)(=O)NC(c2ccccc2)C(N)c2ccccc2)c1 |
| InChI | InChI=1S/C22H24N2O3S/c1-27-20-14-8-9-17(15-20)16-28(25,26)24-22(19-12-6-3-7-13-19)21(23)18-10-4-2-5-11-18/h2-15,21-22,24H,16,23H2,1H3 |
| InChIKey | FPRJTJYJMOWMIV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |