C27H26N2O2S — CID 59537666
N-(2-amino-1,2-diphenylethyl)-1-(4-phenylphenyl)methanesulfonamide (PubChem CID 59537666) has the molecular formula C27H26N2O2S and a molecular weight of 442.58 g/mol. Its IUPAC name is N-(2-amino-1,2-diphenylethyl)-1-(4-phenylphenyl)methanesulfonamide.
| Compound Name | N-(2-amino-1,2-diphenylethyl)-1-(4-phenylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 59537666 |
| Molecular Formula | C27H26N2O2S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-(2-amino-1,2-diphenylethyl)-1-(4-phenylphenyl)methanesulfonamide |
| SMILES | NC(c1ccccc1)C(NS(=O)(=O)Cc1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O2S/c28-26(24-12-6-2-7-13-24)27(25-14-8-3-9-15-25)29-32(30,31)20-21-16-18-23(19-17-21)22-10-4-1-5-11-22/h1-19,26-27,29H,20,28H2 |
| InChIKey | UQUCWLLDVUWMJY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |