C28H28N2O2S — CID 102080788
N-[(1R,2R)-2-amino-1,2-diphenylethyl]-2-(4-phenylphenyl)ethanesulfonamide (PubChem CID 102080788) has the molecular formula C28H28N2O2S and a molecular weight of 456.61 g/mol. Its IUPAC name is N-[(1R,2R)-2-amino-1,2-diphenylethyl]-2-(4-phenylphenyl)ethanesulfonamide.
| Compound Name | N-[(1R,2R)-2-amino-1,2-diphenylethyl]-2-(4-phenylphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 102080788 |
| Molecular Formula | C28H28N2O2S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | N-[(1R,2R)-2-amino-1,2-diphenylethyl]-2-(4-phenylphenyl)ethanesulfonamide |
| SMILES | N[C@H](c1ccccc1)[C@H](NS(=O)(=O)CCc1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H28N2O2S/c29-27(25-12-6-2-7-13-25)28(26-14-8-3-9-15-26)30-33(31,32)21-20-22-16-18-24(19-17-22)23-10-4-1-5-11-23/h1-19,27-28,30H,20-21,29H2/t27-,28-/m1/s1 |
| InChIKey | FIVPGJNPKAYTCC-VSGBNLITSA-N |
| XLogP | 5.26 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |