C25H24N2O2S — CID 59537514
N-(2-amino-1,2-diphenylethyl)-1-naphthalen-2-ylmethanesulfonamide (PubChem CID 59537514) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-(2-amino-1,2-diphenylethyl)-1-naphthalen-2-ylmethanesulfonamide.
| Compound Name | N-(2-amino-1,2-diphenylethyl)-1-naphthalen-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 59537514 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-(2-amino-1,2-diphenylethyl)-1-naphthalen-2-ylmethanesulfonamide |
| SMILES | NC(c1ccccc1)C(NS(=O)(=O)Cc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C25H24N2O2S/c26-24(21-10-3-1-4-11-21)25(22-12-5-2-6-13-22)27-30(28,29)18-19-15-16-20-9-7-8-14-23(20)17-19/h1-17,24-25,27H,18,26H2 |
| InChIKey | SJOGNAIKGLXPLC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |