C33H30N2O2S — CID 59537660
N-(2-amino-1,2-diphenylethyl)-1-(2,6-diphenylphenyl)methanesulfonamide (PubChem CID 59537660) has the molecular formula C33H30N2O2S and a molecular weight of 518.68 g/mol. Its IUPAC name is N-(2-amino-1,2-diphenylethyl)-1-(2,6-diphenylphenyl)methanesulfonamide.
| Compound Name | N-(2-amino-1,2-diphenylethyl)-1-(2,6-diphenylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 59537660 |
| Molecular Formula | C33H30N2O2S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | N-(2-amino-1,2-diphenylethyl)-1-(2,6-diphenylphenyl)methanesulfonamide |
| SMILES | NC(c1ccccc1)C(NS(=O)(=O)Cc1c(-c2ccccc2)cccc1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H30N2O2S/c34-32(27-18-9-3-10-19-27)33(28-20-11-4-12-21-28)35-38(36,37)24-31-29(25-14-5-1-6-15-25)22-13-23-30(31)26-16-7-2-8-17-26/h1-23,32-33,35H,24,34H2 |
| InChIKey | GXUYFHYCOHAIFT-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |