C22H32N2O2S — CID 59537696
N-(2-amino-1,2-diphenylethyl)-3-methyl-2-propan-2-ylbutane-1-sulfonamide (PubChem CID 59537696) has the molecular formula C22H32N2O2S and a molecular weight of 388.58 g/mol. Its IUPAC name is N-(2-amino-1,2-diphenylethyl)-3-methyl-2-propan-2-ylbutane-1-sulfonamide.
| Compound Name | N-(2-amino-1,2-diphenylethyl)-3-methyl-2-propan-2-ylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 59537696 |
| Molecular Formula | C22H32N2O2S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-(2-amino-1,2-diphenylethyl)-3-methyl-2-propan-2-ylbutane-1-sulfonamide |
| SMILES | CC(C)C(CS(=O)(=O)NC(c1ccccc1)C(N)c1ccccc1)C(C)C |
| InChI | InChI=1S/C22H32N2O2S/c1-16(2)20(17(3)4)15-27(25,26)24-22(19-13-9-6-10-14-19)21(23)18-11-7-5-8-12-18/h5-14,16-17,20-22,24H,15,23H2,1-4H3 |
| InChIKey | SJNCNPHHAFZPTB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |