C17H21NO2S — CID 33038977
N-[(1S)-2-methyl-1-phenylpropyl]-1-phenylmethanesulfonamide (PubChem CID 33038977) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is N-[(1S)-2-methyl-1-phenylpropyl]-1-phenylmethanesulfonamide.
| Compound Name | N-[(1S)-2-methyl-1-phenylpropyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 33038977 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[(1S)-2-methyl-1-phenylpropyl]-1-phenylmethanesulfonamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H21NO2S/c1-14(2)17(16-11-7-4-8-12-16)18-21(19,20)13-15-9-5-3-6-10-15/h3-12,14,17-18H,13H2,1-2H3/t17-/m0/s1 |
| InChIKey | VKXRXEHRRZIMSX-KRWDZBQOSA-N |
| XLogP | 3.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |