C15H16BrNO2S — CID 33037887
N-[(1S)-1-(4-bromophenyl)ethyl]-1-phenylmethanesulfonamide (PubChem CID 33037887) has the molecular formula C15H16BrNO2S and a molecular weight of 354.27 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)ethyl]-1-phenylmethanesulfonamide.
| Compound Name | N-[(1S)-1-(4-bromophenyl)ethyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 33037887 |
| Molecular Formula | C15H16BrNO2S |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)ethyl]-1-phenylmethanesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)Cc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H16BrNO2S/c1-12(14-7-9-15(16)10-8-14)17-20(18,19)11-13-5-3-2-4-6-13/h2-10,12,17H,11H2,1H3/t12-/m0/s1 |
| InChIKey | UGMUZDYJDFYDKK-LBPRGKRZSA-N |
| XLogP | 3.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |