C12H19BrN2O2S — CID 106049535
N-[1-(4-bromophenyl)ethyl]-3-(methylamino)propane-1-sulfonamide (PubChem CID 106049535) has the molecular formula C12H19BrN2O2S and a molecular weight of 335.27 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethyl]-3-(methylamino)propane-1-sulfonamide.
| Compound Name | N-[1-(4-bromophenyl)ethyl]-3-(methylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 106049535 |
| Molecular Formula | C12H19BrN2O2S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N-[1-(4-bromophenyl)ethyl]-3-(methylamino)propane-1-sulfonamide |
| SMILES | CNCCCS(=O)(=O)NC(C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H19BrN2O2S/c1-10(11-4-6-12(13)7-5-11)15-18(16,17)9-3-8-14-2/h4-7,10,14-15H,3,8-9H2,1-2H3 |
| InChIKey | CGQIAFLKTCNQQN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|