C12H18ClNO4S2 — CID 43654382
3-chloro-N-[1-(4-methylsulfonylphenyl)ethyl]propane-1-sulfonamide (PubChem CID 43654382) has the molecular formula C12H18ClNO4S2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 3-chloro-N-[1-(4-methylsulfonylphenyl)ethyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[1-(4-methylsulfonylphenyl)ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 43654382 |
| Molecular Formula | C12H18ClNO4S2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 3-chloro-N-[1-(4-methylsulfonylphenyl)ethyl]propane-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)CCCCl)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H18ClNO4S2/c1-10(14-20(17,18)9-3-8-13)11-4-6-12(7-5-11)19(2,15)16/h4-7,10,14H,3,8-9H2,1-2H3 |
| InChIKey | YHDHEESVJCYGDT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|