C12H18ClNO2S — CID 107858598
3-chloro-N-[(1R)-1-(3-methylphenyl)ethyl]propane-1-sulfonamide (PubChem CID 107858598) has the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. Its IUPAC name is 3-chloro-N-[(1R)-1-(3-methylphenyl)ethyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[(1R)-1-(3-methylphenyl)ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 107858598 |
| Molecular Formula | C12H18ClNO2S |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 3-chloro-N-[(1R)-1-(3-methylphenyl)ethyl]propane-1-sulfonamide |
| SMILES | Cc1cccc([C@@H](C)NS(=O)(=O)CCCCl)c1 |
| InChI | InChI=1S/C12H18ClNO2S/c1-10-5-3-6-12(9-10)11(2)14-17(15,16)8-4-7-13/h3,5-6,9,11,14H,4,7-8H2,1-2H3/t11-/m1/s1 |
| InChIKey | LVGIHMQCAOMULI-LLVKDONJSA-N |
| XLogP | 2.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|