C13H20ClNO2S — CID 54877728
3-chloro-N-[1-(2,5-dimethylphenyl)ethyl]propane-1-sulfonamide (PubChem CID 54877728) has the molecular formula C13H20ClNO2S and a molecular weight of 289.83 g/mol. Its IUPAC name is 3-chloro-N-[1-(2,5-dimethylphenyl)ethyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[1-(2,5-dimethylphenyl)ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 54877728 |
| Molecular Formula | C13H20ClNO2S |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-chloro-N-[1-(2,5-dimethylphenyl)ethyl]propane-1-sulfonamide |
| SMILES | Cc1ccc(C)c(C(C)NS(=O)(=O)CCCCl)c1 |
| InChI | InChI=1S/C13H20ClNO2S/c1-10-5-6-11(2)13(9-10)12(3)15-18(16,17)8-4-7-14/h5-6,9,12,15H,4,7-8H2,1-3H3 |
| InChIKey | BXBWTGZYFVWZJN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|