C12H17Cl2NO2S — CID 116815054
4-chloro-N-[1-(2-chlorophenyl)ethyl]butane-1-sulfonamide (PubChem CID 116815054) has the molecular formula C12H17Cl2NO2S and a molecular weight of 310.25 g/mol. Its IUPAC name is 4-chloro-N-[1-(2-chlorophenyl)ethyl]butane-1-sulfonamide.
| Compound Name | 4-chloro-N-[1-(2-chlorophenyl)ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 116815054 |
| Molecular Formula | C12H17Cl2NO2S |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-chloro-N-[1-(2-chlorophenyl)ethyl]butane-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)CCCCCl)c1ccccc1Cl |
| InChI | InChI=1S/C12H17Cl2NO2S/c1-10(11-6-2-3-7-12(11)14)15-18(16,17)9-5-4-8-13/h2-3,6-7,10,15H,4-5,8-9H2,1H3 |
| InChIKey | QAFWDZLFZCFLLN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|