C16H26ClNO3S — CID 146353116
N-[(1R)-1-(2-chlorophenyl)ethyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide (PubChem CID 146353116) has the molecular formula C16H26ClNO3S and a molecular weight of 347.91 g/mol. Its IUPAC name is N-[(1R)-1-(2-chlorophenyl)ethyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide.
| Compound Name | N-[(1R)-1-(2-chlorophenyl)ethyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide |
|---|---|
| PubChem CID | 146353116 |
| Molecular Formula | C16H26ClNO3S |
| Molecular Weight | 347.91 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[(1R)-1-(2-chlorophenyl)ethyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCOCC(C)(C)C)c1ccccc1Cl |
| InChI | InChI=1S/C16H26ClNO3S/c1-13(14-8-5-6-9-15(14)17)18-22(19,20)11-7-10-21-12-16(2,3)4/h5-6,8-9,13,18H,7,10-12H2,1-4H3/t13-/m1/s1 |
| InChIKey | MOQBQFWLHVVILE-CYBMUJFWSA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.91 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|