C22H37NO4S — CID 146352828
N-[(1R)-1-[3-(cyclopentylmethoxy)phenyl]ethyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide (PubChem CID 146352828) has the molecular formula C22H37NO4S and a molecular weight of 411.61 g/mol. Its IUPAC name is N-[(1R)-1-[3-(cyclopentylmethoxy)phenyl]ethyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide.
| Compound Name | N-[(1R)-1-[3-(cyclopentylmethoxy)phenyl]ethyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide |
|---|---|
| PubChem CID | 146352828 |
| Molecular Formula | C22H37NO4S |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | N-[(1R)-1-[3-(cyclopentylmethoxy)phenyl]ethyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCOCC(C)(C)C)c1cccc(OCC2CCCC2)c1 |
| InChI | InChI=1S/C22H37NO4S/c1-18(23-28(24,25)14-8-13-26-17-22(2,3)4)20-11-7-12-21(15-20)27-16-19-9-5-6-10-19/h7,11-12,15,18-19,23H,5-6,8-10,13-14,16-17H2,1-4H3/t18-/m1/s1 |
| InChIKey | BZQZSAZKFRGKBR-GOSISDBHSA-N |
| XLogP | 4.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|