C20H32FNO4S — CID 146353456
N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide (PubChem CID 146353456) has the molecular formula C20H32FNO4S and a molecular weight of 401.54 g/mol. Its IUPAC name is N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide.
| Compound Name | N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide |
|---|---|
| PubChem CID | 146353456 |
| Molecular Formula | C20H32FNO4S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCOCC(C)(C)C)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C20H32FNO4S/c1-15(22-27(23,24)11-5-10-25-14-20(2,3)4)17-8-9-18(21)19(12-17)26-13-16-6-7-16/h8-9,12,15-16,22H,5-7,10-11,13-14H2,1-4H3/t15-/m1/s1 |
| InChIKey | LOHQLPNCZYIDDD-OAHLLOKOSA-N |
| XLogP | 4.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|