C22H32FN3O5S — CID 155370251
N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-5-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide (PubChem CID 155370251) has the molecular formula C22H32FN3O5S and a molecular weight of 469.58 g/mol. Its IUPAC name is N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-5-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide.
| Compound Name | N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-5-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 155370251 |
| Molecular Formula | C22H32FN3O5S |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-5-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCCCN1C(=O)NC(=O)C1(C)C)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C22H32FN3O5S/c1-15(17-9-10-18(23)19(13-17)31-14-16-7-8-16)25-32(29,30)12-6-4-5-11-26-21(28)24-20(27)22(26,2)3/h9-10,13,15-16,25H,4-8,11-12,14H2,1-3H3,(H,24,27,28)/t15-/m1/s1 |
| InChIKey | ZSEQJFWWKCHHJV-OAHLLOKOSA-N |
| XLogP | 3.10 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|