C20H27FN2O6S — CID 146426259
N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-3-[(2,5-dioxopyrrolidin-3-yl)methoxy]propane-1-sulfonamide (PubChem CID 146426259) has the molecular formula C20H27FN2O6S and a molecular weight of 442.51 g/mol. Its IUPAC name is N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-3-[(2,5-dioxopyrrolidin-3-yl)methoxy]propane-1-sulfonamide.
| Compound Name | N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-3-[(2,5-dioxopyrrolidin-3-yl)methoxy]propane-1-sulfonamide |
|---|---|
| PubChem CID | 146426259 |
| Molecular Formula | C20H27FN2O6S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-3-[(2,5-dioxopyrrolidin-3-yl)methoxy]propane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCOCC1CC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C20H27FN2O6S/c1-13(15-5-6-17(21)18(9-15)29-11-14-3-4-14)23-30(26,27)8-2-7-28-12-16-10-19(24)22-20(16)25/h5-6,9,13-14,16,23H,2-4,7-8,10-12H2,1H3,(H,22,24,25)/t13-,16?/m1/s1 |
| InChIKey | QITRYPCOIRBGPL-JBZHPUCOSA-N |
| XLogP | 1.66 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|