C23H25FN2O5S — CID 146228283
N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-3-(1,3-dioxoisoindol-5-yl)propane-1-sulfonamide (PubChem CID 146228283) has the molecular formula C23H25FN2O5S and a molecular weight of 460.53 g/mol. Its IUPAC name is N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-3-(1,3-dioxoisoindol-5-yl)propane-1-sulfonamide.
| Compound Name | N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-3-(1,3-dioxoisoindol-5-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 146228283 |
| Molecular Formula | C23H25FN2O5S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | N-[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-3-(1,3-dioxoisoindol-5-yl)propane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCc1ccc2c(c1)C(=O)NC2=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C23H25FN2O5S/c1-14(17-7-9-20(24)21(12-17)31-13-16-4-5-16)26-32(29,30)10-2-3-15-6-8-18-19(11-15)23(28)25-22(18)27/h6-9,11-12,14,16,26H,2-5,10,13H2,1H3,(H,25,27,28)/t14-/m1/s1 |
| InChIKey | FMMBFXIFVFYZDR-CQSZACIVSA-N |
| XLogP | 3.11 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|