C21H30FN3O5S — CID 155347003
N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-5-[(5S)-5-methyl-2,4-dioxoimidazolidin-1-yl]pentane-1-sulfonamide (PubChem CID 155347003) has the molecular formula C21H30FN3O5S and a molecular weight of 455.55 g/mol. Its IUPAC name is N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-5-[(5S)-5-methyl-2,4-dioxoimidazolidin-1-yl]pentane-1-sulfonamide.
| Compound Name | N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-5-[(5S)-5-methyl-2,4-dioxoimidazolidin-1-yl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 155347003 |
| Molecular Formula | C21H30FN3O5S |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]ethyl]-5-[(5S)-5-methyl-2,4-dioxoimidazolidin-1-yl]pentane-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)CCCCCN1C(=O)NC(=O)[C@@H]1C)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H30FN3O5S/c1-14(17-8-9-18(22)19(12-17)30-13-16-6-7-16)24-31(28,29)11-5-3-4-10-25-15(2)20(26)23-21(25)27/h8-9,12,14-16,24H,3-7,10-11,13H2,1-2H3,(H,23,26,27)/t14?,15-/m0/s1 |
| InChIKey | IDXFRPYZAKNNDT-LOACHALJSA-N |
| XLogP | 2.71 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|