C21H32FN3O5S — CID 155346996
N-[(1R)-1-[4-fluoro-3-(2-methylpropoxy)phenyl]ethyl]-5-(5-methyl-2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide (PubChem CID 155346996) has the molecular formula C21H32FN3O5S and a molecular weight of 457.57 g/mol. Its IUPAC name is N-[(1R)-1-[4-fluoro-3-(2-methylpropoxy)phenyl]ethyl]-5-(5-methyl-2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide.
| Compound Name | N-[(1R)-1-[4-fluoro-3-(2-methylpropoxy)phenyl]ethyl]-5-(5-methyl-2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 155346996 |
| Molecular Formula | C21H32FN3O5S |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[(1R)-1-[4-fluoro-3-(2-methylpropoxy)phenyl]ethyl]-5-(5-methyl-2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
| SMILES | CC(C)COc1cc([C@@H](C)NS(=O)(=O)CCCCCN2C(=O)NC(=O)C2C)ccc1F |
| InChI | InChI=1S/C21H32FN3O5S/c1-14(2)13-30-19-12-17(8-9-18(19)22)15(3)24-31(28,29)11-7-5-6-10-25-16(4)20(26)23-21(25)27/h8-9,12,14-16,24H,5-7,10-11,13H2,1-4H3,(H,23,26,27)/t15-,16?/m1/s1 |
| InChIKey | GQHYNCFHFJYWQU-AAFJCEBUSA-N |
| XLogP | 2.95 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|