C20H30FN3O6S — CID 134541500
5-(2,4-dioxoimidazolidin-1-yl)-N-[1-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]ethyl]pentane-1-sulfonamide (PubChem CID 134541500) has the molecular formula C20H30FN3O6S and a molecular weight of 459.54 g/mol. Its IUPAC name is 5-(2,4-dioxoimidazolidin-1-yl)-N-[1-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]ethyl]pentane-1-sulfonamide.
| Compound Name | 5-(2,4-dioxoimidazolidin-1-yl)-N-[1-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]ethyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 134541500 |
| Molecular Formula | C20H30FN3O6S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 5-(2,4-dioxoimidazolidin-1-yl)-N-[1-[4-fluoro-3-(2-hydroxy-2-methylpropoxy)phenyl]ethyl]pentane-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)CCCCCN1CC(=O)NC1=O)c1ccc(F)c(OCC(C)(C)O)c1 |
| InChI | InChI=1S/C20H30FN3O6S/c1-14(15-7-8-16(21)17(11-15)30-13-20(2,3)27)23-31(28,29)10-6-4-5-9-24-12-18(25)22-19(24)26/h7-8,11,14,23,27H,4-6,9-10,12-13H2,1-3H3,(H,22,25,26) |
| InChIKey | OWWFZMCTSMIWTD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|