C23H33FN4O5S — CID 155370104
N-[(R)-[3-(cyclopropylmethoxy)-4-fluorophenyl]-(1-methylazetidin-3-yl)methyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide (PubChem CID 155370104) has the molecular formula C23H33FN4O5S and a molecular weight of 496.61 g/mol. Its IUPAC name is N-[(R)-[3-(cyclopropylmethoxy)-4-fluorophenyl]-(1-methylazetidin-3-yl)methyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide.
| Compound Name | N-[(R)-[3-(cyclopropylmethoxy)-4-fluorophenyl]-(1-methylazetidin-3-yl)methyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 155370104 |
| Molecular Formula | C23H33FN4O5S |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | N-[(R)-[3-(cyclopropylmethoxy)-4-fluorophenyl]-(1-methylazetidin-3-yl)methyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
| SMILES | CN1CC([C@@H](NS(=O)(=O)CCCCCN2CC(=O)NC2=O)c2ccc(F)c(OCC3CC3)c2)C1 |
| InChI | InChI=1S/C23H33FN4O5S/c1-27-12-18(13-27)22(17-7-8-19(24)20(11-17)33-15-16-5-6-16)26-34(31,32)10-4-2-3-9-28-14-21(29)25-23(28)30/h7-8,11,16,18,22,26H,2-6,9-10,12-15H2,1H3,(H,25,29,30)/t22-/m0/s1 |
| InChIKey | MIQAPWGAXQZLRN-QFIPXVFZSA-N |
| XLogP | 1.86 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|