C22H30FN3O6S — CID 142360664
N-[[3-(cyclopropylmethoxy)-4-fluorophenyl]-(oxetan-3-yl)methyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide (PubChem CID 142360664) has the molecular formula C22H30FN3O6S and a molecular weight of 483.56 g/mol. Its IUPAC name is N-[[3-(cyclopropylmethoxy)-4-fluorophenyl]-(oxetan-3-yl)methyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide.
| Compound Name | N-[[3-(cyclopropylmethoxy)-4-fluorophenyl]-(oxetan-3-yl)methyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 142360664 |
| Molecular Formula | C22H30FN3O6S |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-[[3-(cyclopropylmethoxy)-4-fluorophenyl]-(oxetan-3-yl)methyl]-5-(2,4-dioxoimidazolidin-1-yl)pentane-1-sulfonamide |
| SMILES | O=C1CN(CCCCCS(=O)(=O)NC(c2ccc(F)c(OCC3CC3)c2)C2COC2)C(=O)N1 |
| InChI | InChI=1S/C22H30FN3O6S/c23-18-7-6-16(10-19(18)32-12-15-4-5-15)21(17-13-31-14-17)25-33(29,30)9-3-1-2-8-26-11-20(27)24-22(26)28/h6-7,10,15,17,21,25H,1-5,8-9,11-14H2,(H,24,27,28) |
| InChIKey | YALQMRWKOSBSPE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|