C23H31FN2O5S — CID 149254670
1-[5-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclobutyl]methylsulfonyl]pentyl]imidazolidine-2,4-dione (PubChem CID 149254670) has the molecular formula C23H31FN2O5S and a molecular weight of 466.58 g/mol. Its IUPAC name is 1-[5-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclobutyl]methylsulfonyl]pentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclobutyl]methylsulfonyl]pentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 149254670 |
| Molecular Formula | C23H31FN2O5S |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 1-[5-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclobutyl]methylsulfonyl]pentyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(CCCCCS(=O)(=O)CC2(c3ccc(F)c(OCC4CC4)c3)CCC2)C(=O)N1 |
| InChI | InChI=1S/C23H31FN2O5S/c24-19-8-7-18(13-20(19)31-15-17-5-6-17)23(9-4-10-23)16-32(29,30)12-3-1-2-11-26-14-21(27)25-22(26)28/h7-8,13,17H,1-6,9-12,14-16H2,(H,25,27,28) |
| InChIKey | XOAWHMRFFWSSOL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|