C21H28FN3O3S — CID 145227574
1-[5-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]amino]sulfanylpentyl]imidazolidine-2,4-dione (PubChem CID 145227574) has the molecular formula C21H28FN3O3S and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-[5-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]amino]sulfanylpentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]amino]sulfanylpentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 145227574 |
| Molecular Formula | C21H28FN3O3S |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 1-[5-[[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]amino]sulfanylpentyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(CCCCCSNC2(c3ccc(F)c(OCC4CC4)c3)CC2)C(=O)N1 |
| InChI | InChI=1S/C21H28FN3O3S/c22-17-7-6-16(12-18(17)28-14-15-4-5-15)21(8-9-21)24-29-11-3-1-2-10-25-13-19(26)23-20(25)27/h6-7,12,15,24H,1-5,8-11,13-14H2,(H,23,26,27) |
| InChIKey | YTDBLIWQJFXPLW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|