C21H28FN3O6S — CID 162531925
3-[3-(cyclopropylmethoxy)-4-fluorophenyl]-3-[5-(2,4-dioxoimidazolidin-1-yl)pentylsulfinylamino]propanoic acid (PubChem CID 162531925) has the molecular formula C21H28FN3O6S and a molecular weight of 469.54 g/mol. Its IUPAC name is 3-[3-(cyclopropylmethoxy)-4-fluorophenyl]-3-[5-(2,4-dioxoimidazolidin-1-yl)pentylsulfinylamino]propanoic acid.
| Compound Name | 3-[3-(cyclopropylmethoxy)-4-fluorophenyl]-3-[5-(2,4-dioxoimidazolidin-1-yl)pentylsulfinylamino]propanoic acid |
|---|---|
| PubChem CID | 162531925 |
| Molecular Formula | C21H28FN3O6S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 3-[3-(cyclopropylmethoxy)-4-fluorophenyl]-3-[5-(2,4-dioxoimidazolidin-1-yl)pentylsulfinylamino]propanoic acid |
| SMILES | O=C(O)CC(NS(=O)CCCCCN1CC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H28FN3O6S/c22-16-7-6-15(10-18(16)31-13-14-4-5-14)17(11-20(27)28)24-32(30)9-3-1-2-8-25-12-19(26)23-21(25)29/h6-7,10,14,17,24H,1-5,8-9,11-13H2,(H,27,28)(H,23,26,29) |
| InChIKey | HPCVDUJQBPSOLU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|