C22H33FN4O3 — CID 142360570
1-[5-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]hydrazinyl]pentyl]imidazolidine-2,4-dione (PubChem CID 142360570) has the molecular formula C22H33FN4O3 and a molecular weight of 420.53 g/mol. Its IUPAC name is 1-[5-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]hydrazinyl]pentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]hydrazinyl]pentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 142360570 |
| Molecular Formula | C22H33FN4O3 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 1-[5-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]hydrazinyl]pentyl]imidazolidine-2,4-dione |
| SMILES | CCCC(NNCCCCCN1CC(=O)NC1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C22H33FN4O3/c1-2-6-19(17-9-10-18(23)20(13-17)30-15-16-7-8-16)26-24-11-4-3-5-12-27-14-21(28)25-22(27)29/h9-10,13,16,19,24,26H,2-8,11-12,14-15H2,1H3,(H,25,28,29) |
| InChIKey | YUZAHBHLXFTGJQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|