C21H30FN5O3 — CID 142360872
1-[5-[2-[3-[3-(cyclopropylmethoxy)-4-fluorophenyl]azetidin-3-yl]hydrazinyl]pentyl]imidazolidine-2,4-dione (PubChem CID 142360872) has the molecular formula C21H30FN5O3 and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-[5-[2-[3-[3-(cyclopropylmethoxy)-4-fluorophenyl]azetidin-3-yl]hydrazinyl]pentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[2-[3-[3-(cyclopropylmethoxy)-4-fluorophenyl]azetidin-3-yl]hydrazinyl]pentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 142360872 |
| Molecular Formula | C21H30FN5O3 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 1-[5-[2-[3-[3-(cyclopropylmethoxy)-4-fluorophenyl]azetidin-3-yl]hydrazinyl]pentyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(CCCCCNNC2(c3ccc(F)c(OCC4CC4)c3)CNC2)C(=O)N1 |
| InChI | InChI=1S/C21H30FN5O3/c22-17-7-6-16(10-18(17)30-12-15-4-5-15)21(13-23-14-21)26-24-8-2-1-3-9-27-11-19(28)25-20(27)29/h6-7,10,15,23-24,26H,1-5,8-9,11-14H2,(H,25,28,29) |
| InChIKey | SRNDYFRXVIKEFR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|