C17H26FN3O — CID 142360229
4-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]hydrazinyl]butan-1-amine (PubChem CID 142360229) has the molecular formula C17H26FN3O and a molecular weight of 307.41 g/mol. Its IUPAC name is 4-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]hydrazinyl]butan-1-amine.
| Compound Name | 4-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]hydrazinyl]butan-1-amine |
|---|---|
| PubChem CID | 142360229 |
| Molecular Formula | C17H26FN3O |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 4-[2-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]hydrazinyl]butan-1-amine |
| SMILES | NCCCCNNC1(c2ccc(F)c(OCC3CC3)c2)CC1 |
| InChI | InChI=1S/C17H26FN3O/c18-15-6-5-14(11-16(15)22-12-13-3-4-13)17(7-8-17)21-20-10-2-1-9-19/h5-6,11,13,20-21H,1-4,7-10,12,19H2 |
| InChIKey | MIGSYWGGMUJPQH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|