C17H24FNO4S — CID 170119509
N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-3-methoxypropane-1-sulfonamide (PubChem CID 170119509) has the molecular formula C17H24FNO4S and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-3-methoxypropane-1-sulfonamide.
| Compound Name | N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-3-methoxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 170119509 |
| Molecular Formula | C17H24FNO4S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-3-methoxypropane-1-sulfonamide |
| SMILES | COCCCS(=O)(=O)NC1(c2ccc(F)c(OCC3CC3)c2)CC1 |
| InChI | InChI=1S/C17H24FNO4S/c1-22-9-2-10-24(20,21)19-17(7-8-17)14-5-6-15(18)16(11-14)23-12-13-3-4-13/h5-6,11,13,19H,2-4,7-10,12H2,1H3 |
| InChIKey | VUBWFDSORIHSTQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|