C23H36FNO3S — CID 146352826
N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-7,7-dimethyloctane-1-sulfonamide (PubChem CID 146352826) has the molecular formula C23H36FNO3S and a molecular weight of 425.61 g/mol. Its IUPAC name is N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-7,7-dimethyloctane-1-sulfonamide.
| Compound Name | N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-7,7-dimethyloctane-1-sulfonamide |
|---|---|
| PubChem CID | 146352826 |
| Molecular Formula | C23H36FNO3S |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | N-[1-[3-(cyclopropylmethoxy)-4-fluorophenyl]cyclopropyl]-7,7-dimethyloctane-1-sulfonamide |
| SMILES | CC(C)(C)CCCCCCS(=O)(=O)NC1(c2ccc(F)c(OCC3CC3)c2)CC1 |
| InChI | InChI=1S/C23H36FNO3S/c1-22(2,3)12-6-4-5-7-15-29(26,27)25-23(13-14-23)19-10-11-20(24)21(16-19)28-17-18-8-9-18/h10-11,16,18,25H,4-9,12-15,17H2,1-3H3 |
| InChIKey | NWMQEPIMYJMVNT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|