C22H36FNO4S — CID 146352870
N-[(2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]-5,5-dimethylhexane-1-sulfonamide (PubChem CID 146352870) has the molecular formula C22H36FNO4S and a molecular weight of 429.60 g/mol. Its IUPAC name is N-[(2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]-5,5-dimethylhexane-1-sulfonamide.
| Compound Name | N-[(2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]-5,5-dimethylhexane-1-sulfonamide |
|---|---|
| PubChem CID | 146352870 |
| Molecular Formula | C22H36FNO4S |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | N-[(2S)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxybutyl]-5,5-dimethylhexane-1-sulfonamide |
| SMILES | CC[C@@](O)(CNS(=O)(=O)CCCCC(C)(C)C)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C22H36FNO4S/c1-5-22(25,16-24-29(26,27)13-7-6-12-21(2,3)4)18-10-11-19(23)20(14-18)28-15-17-8-9-17/h10-11,14,17,24-25H,5-9,12-13,15-16H2,1-4H3/t22-/m1/s1 |
| InChIKey | YXKUUNRPJONZMY-JOCHJYFZSA-N |
| XLogP | 4.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|