C21H34FNO4S — CID 146352817
N-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxypropyl]-5,5-dimethylhexane-1-sulfonamide (PubChem CID 146352817) has the molecular formula C21H34FNO4S and a molecular weight of 415.57 g/mol. Its IUPAC name is N-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxypropyl]-5,5-dimethylhexane-1-sulfonamide.
| Compound Name | N-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxypropyl]-5,5-dimethylhexane-1-sulfonamide |
|---|---|
| PubChem CID | 146352817 |
| Molecular Formula | C21H34FNO4S |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | N-[2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-hydroxypropyl]-5,5-dimethylhexane-1-sulfonamide |
| SMILES | CC(C)(C)CCCCS(=O)(=O)NCC(C)(O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C21H34FNO4S/c1-20(2,3)11-5-6-12-28(25,26)23-15-21(4,24)17-9-10-18(22)19(13-17)27-14-16-7-8-16/h9-10,13,16,23-24H,5-8,11-12,14-15H2,1-4H3 |
| InChIKey | MDVFSKHBWYSIHO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|