C25H33F2NO4S — CID 146352906
N-[[3-(cyclopropylmethoxy)-4-fluorophenyl]-(4-fluorophenyl)methyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide (PubChem CID 146352906) has the molecular formula C25H33F2NO4S and a molecular weight of 481.61 g/mol. Its IUPAC name is N-[[3-(cyclopropylmethoxy)-4-fluorophenyl]-(4-fluorophenyl)methyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide.
| Compound Name | N-[[3-(cyclopropylmethoxy)-4-fluorophenyl]-(4-fluorophenyl)methyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide |
|---|---|
| PubChem CID | 146352906 |
| Molecular Formula | C25H33F2NO4S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N-[[3-(cyclopropylmethoxy)-4-fluorophenyl]-(4-fluorophenyl)methyl]-3-(2,2-dimethylpropoxy)propane-1-sulfonamide |
| SMILES | CC(C)(C)COCCCS(=O)(=O)NC(c1ccc(F)cc1)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C25H33F2NO4S/c1-25(2,3)17-31-13-4-14-33(29,30)28-24(19-7-10-21(26)11-8-19)20-9-12-22(27)23(15-20)32-16-18-5-6-18/h7-12,15,18,24,28H,4-6,13-14,16-17H2,1-3H3 |
| InChIKey | ZPNLYHIXOGFSJL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|