C19H28FNO5S — CID 155370300
3-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]sulfamoyl]propyl acetate (PubChem CID 155370300) has the molecular formula C19H28FNO5S and a molecular weight of 401.50 g/mol. Its IUPAC name is 3-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]sulfamoyl]propyl acetate.
| Compound Name | 3-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]sulfamoyl]propyl acetate |
|---|---|
| PubChem CID | 155370300 |
| Molecular Formula | C19H28FNO5S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-[[(1R)-1-[3-(cyclopropylmethoxy)-4-fluorophenyl]butyl]sulfamoyl]propyl acetate |
| SMILES | CCC[C@@H](NS(=O)(=O)CCCOC(C)=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C19H28FNO5S/c1-3-5-18(21-27(23,24)11-4-10-25-14(2)22)16-8-9-17(20)19(12-16)26-13-15-6-7-15/h8-9,12,15,18,21H,3-7,10-11,13H2,1-2H3/t18-/m1/s1 |
| InChIKey | FULZHXFBZVBXDS-GOSISDBHSA-N |
| XLogP | 3.33 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|