C18H26FNO5S — CID 153312148
3-[[(1R)-1-(3-cyclopentyloxy-4-fluorophenyl)ethyl]sulfamoyl]propyl acetate (PubChem CID 153312148) has the molecular formula C18H26FNO5S and a molecular weight of 387.47 g/mol. Its IUPAC name is 3-[[(1R)-1-(3-cyclopentyloxy-4-fluorophenyl)ethyl]sulfamoyl]propyl acetate.
| Compound Name | 3-[[(1R)-1-(3-cyclopentyloxy-4-fluorophenyl)ethyl]sulfamoyl]propyl acetate |
|---|---|
| PubChem CID | 153312148 |
| Molecular Formula | C18H26FNO5S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 3-[[(1R)-1-(3-cyclopentyloxy-4-fluorophenyl)ethyl]sulfamoyl]propyl acetate |
| SMILES | CC(=O)OCCCS(=O)(=O)N[C@H](C)c1ccc(F)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C18H26FNO5S/c1-13(20-26(22,23)11-5-10-24-14(2)21)15-8-9-17(19)18(12-15)25-16-6-3-4-7-16/h8-9,12-13,16,20H,3-7,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | AYYRJVRNEFDGSS-CYBMUJFWSA-N |
| XLogP | 3.08 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|